C17H18N4O — CID 174385560
4-(aminomethyl)-2-(2H-benzotriazol-4-yl)-6-but-2-enylphenol (PubChem CID 174385560) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 4-(aminomethyl)-2-(2H-benzotriazol-4-yl)-6-but-2-enylphenol.
| Compound Name | 4-(aminomethyl)-2-(2H-benzotriazol-4-yl)-6-but-2-enylphenol |
|---|---|
| PubChem CID | 174385560 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 4-(aminomethyl)-2-(2H-benzotriazol-4-yl)-6-but-2-enylphenol |
| SMILES | CC=CCc1cc(CN)cc(-c2cccc3n[nH]nc23)c1O |
| InChI | InChI=1S/C17H18N4O/c1-2-3-5-12-8-11(10-18)9-14(17(12)22)13-6-4-7-15-16(13)20-21-19-15/h2-4,6-9,22H,5,10,18H2,1H3,(H,19,20,21) |
| InChIKey | PEQAFBWIWSFHSZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|