C20H20Cl2O2 — CID 77387302
4-but-2-enyl-2-(3-but-2-enyl-5-chloro-4-hydroxyphenyl)-6-chlorophenol (PubChem CID 77387302) has the molecular formula C20H20Cl2O2 and a molecular weight of 363.28 g/mol. Its IUPAC name is 4-but-2-enyl-2-(3-but-2-enyl-5-chloro-4-hydroxyphenyl)-6-chlorophenol.
| Compound Name | 4-but-2-enyl-2-(3-but-2-enyl-5-chloro-4-hydroxyphenyl)-6-chlorophenol |
|---|---|
| PubChem CID | 77387302 |
| Molecular Formula | C20H20Cl2O2 |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 4-but-2-enyl-2-(3-but-2-enyl-5-chloro-4-hydroxyphenyl)-6-chlorophenol |
| SMILES | CC=CCc1cc(Cl)c(O)c(-c2cc(Cl)c(O)c(CC=CC)c2)c1 |
| InChI | InChI=1S/C20H20Cl2O2/c1-3-5-7-13-9-16(20(24)17(21)10-13)15-11-14(8-6-4-2)19(23)18(22)12-15/h3-6,9-12,23-24H,7-8H2,1-2H3 |
| InChIKey | PHMMSHUAISVTMW-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|