C12H16O — CID 131234251
2-[(E)-but-2-enyl]-4,6-dimethylphenol (PubChem CID 131234251) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-[(E)-but-2-enyl]-4,6-dimethylphenol.
| Compound Name | 2-[(E)-but-2-enyl]-4,6-dimethylphenol |
|---|---|
| PubChem CID | 131234251 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2-[(E)-but-2-enyl]-4,6-dimethylphenol |
| SMILES | C/C=C/Cc1cc(C)cc(C)c1O |
| InChI | InChI=1S/C12H16O/c1-4-5-6-11-8-9(2)7-10(3)12(11)13/h4-5,7-8,13H,6H2,1-3H3/b5-4+ |
| InChIKey | GITHWIUTGFIQHL-SNAWJCMRSA-N |
| XLogP | 3.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|