C30H29NO8 — CID 171607196
[3-[3-carbazol-9-yl-5-(2-hydroxy-3-prop-2-enoyloxypropoxy)phenoxy]-2-hydroxypropyl] prop-2-enoate (PubChem CID 171607196) has the molecular formula C30H29NO8 and a molecular weight of 531.56 g/mol. Its IUPAC name is [3-[3-carbazol-9-yl-5-(2-hydroxy-3-prop-2-enoyloxypropoxy)phenoxy]-2-hydroxypropyl] prop-2-enoate.
| Compound Name | [3-[3-carbazol-9-yl-5-(2-hydroxy-3-prop-2-enoyloxypropoxy)phenoxy]-2-hydroxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 171607196 |
| Molecular Formula | C30H29NO8 |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | [3-[3-carbazol-9-yl-5-(2-hydroxy-3-prop-2-enoyloxypropoxy)phenoxy]-2-hydroxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)COc1cc(OCC(O)COC(=O)C=C)cc(-n2c3ccccc3c3ccccc32)c1 |
| InChI | InChI=1S/C30H29NO8/c1-3-29(34)38-18-21(32)16-36-23-13-20(14-24(15-23)37-17-22(33)19-39-30(35)4-2)31-27-11-7-5-9-25(27)26-10-6-8-12-28(26)31/h3-15,21-22,32-33H,1-2,16-19H2 |
| InChIKey | NQYOPAKVUULUKI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|