C31H43NO10 — CID 155538004
6-[methyl-[2-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyethyl]amino]hexyl 3,4,5-trimethoxybenzoate (PubChem CID 155538004) has the molecular formula C31H43NO10 and a molecular weight of 589.68 g/mol. Its IUPAC name is 6-[methyl-[2-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyethyl]amino]hexyl 3,4,5-trimethoxybenzoate.
| Compound Name | 6-[methyl-[2-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyethyl]amino]hexyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 155538004 |
| Molecular Formula | C31H43NO10 |
| Molecular Weight | 589.68 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | 6-[methyl-[2-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyethyl]amino]hexyl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(/C=C/C(=O)OCCN(C)CCCCCCOC(=O)c2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C31H43NO10/c1-32(15-17-41-28(33)13-12-22-18-24(35-2)29(39-6)25(19-22)36-3)14-10-8-9-11-16-42-31(34)23-20-26(37-4)30(40-7)27(21-23)38-5/h12-13,18-21H,8-11,14-17H2,1-7H3/b13-12+ |
| InChIKey | ATELXDWLTAAUAT-OUKQBFOZSA-N |
| XLogP | 4.64 |
| TPSA | 111.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.68 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|