C28H27NO8 — CID 142190458
5-[(Z)-2-[3-[cyclopropylidene-(4-nitrophenoxy)methoxy]-4-methoxyphenyl]ethenyl]-1,2,3-trimethoxybenzene (PubChem CID 142190458) has the molecular formula C28H27NO8 and a molecular weight of 505.52 g/mol. Its IUPAC name is 5-[(Z)-2-[3-[cyclopropylidene-(4-nitrophenoxy)methoxy]-4-methoxyphenyl]ethenyl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[(Z)-2-[3-[cyclopropylidene-(4-nitrophenoxy)methoxy]-4-methoxyphenyl]ethenyl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 142190458 |
| Molecular Formula | C28H27NO8 |
| Molecular Weight | 505.52 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 5-[(Z)-2-[3-[cyclopropylidene-(4-nitrophenoxy)methoxy]-4-methoxyphenyl]ethenyl]-1,2,3-trimethoxybenzene |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1OC(Oc1ccc([N+](=O)[O-])cc1)=C1CC1 |
| InChI | InChI=1S/C28H27NO8/c1-32-23-14-7-18(5-6-19-16-25(33-2)27(35-4)26(17-19)34-3)15-24(23)37-28(20-8-9-20)36-22-12-10-21(11-13-22)29(30)31/h5-7,10-17H,8-9H2,1-4H3/b6-5- |
| InChIKey | FWJNJBXXPSDPJC-WAYWQWQTSA-N |
| XLogP | 6.26 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|