C28H32O8 — CID 54211473
3-[3,4-bis(oxan-2-yloxy)phenyl]prop-2-enyl 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 54211473) has the molecular formula C28H32O8 and a molecular weight of 496.56 g/mol. Its IUPAC name is 3-[3,4-bis(oxan-2-yloxy)phenyl]prop-2-enyl 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | 3-[3,4-bis(oxan-2-yloxy)phenyl]prop-2-enyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 54211473 |
| Molecular Formula | C28H32O8 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 3-[3,4-bis(oxan-2-yloxy)phenyl]prop-2-enyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)OCC=Cc1ccc(OC2CCCCO2)c(OC2CCCCO2)c1 |
| InChI | InChI=1S/C28H32O8/c29-22-12-9-21(18-23(22)30)11-14-26(31)32-17-5-6-20-10-13-24(35-27-7-1-3-15-33-27)25(19-20)36-28-8-2-4-16-34-28/h5-6,9-14,18-19,27-30H,1-4,7-8,15-17H2 |
| InChIKey | PWGCXVXPVCTXNA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|