C30H44N4O9 — CID 175709875
diethyl (2R)-2-[[(2S)-3-methyl-2-[[2-[[(E)-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]prop-2-enoyl]amino]acetyl]amino]butanoyl]amino]pentanedioate (PubChem CID 175709875) has the molecular formula C30H44N4O9 and a molecular weight of 604.70 g/mol. Its IUPAC name is diethyl (2R)-2-[[(2S)-3-methyl-2-[[2-[[(E)-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]prop-2-enoyl]amino]acetyl]amino]butanoyl]amino]pentanedioate.
| Compound Name | diethyl (2R)-2-[[(2S)-3-methyl-2-[[2-[[(E)-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]prop-2-enoyl]amino]acetyl]amino]butanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 175709875 |
| Molecular Formula | C30H44N4O9 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.31 |
| IUPAC Name | diethyl (2R)-2-[[(2S)-3-methyl-2-[[2-[[(E)-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]prop-2-enoyl]amino]acetyl]amino]butanoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)/C=C/c1ccc(NC(=O)OC(C)(C)C)cc1)C(C)C)C(=O)OCC |
| InChI | InChI=1S/C30H44N4O9/c1-8-41-25(37)17-15-22(28(39)42-9-2)33-27(38)26(19(3)4)34-24(36)18-31-23(35)16-12-20-10-13-21(14-11-20)32-29(40)43-30(5,6)7/h10-14,16,19,22,26H,8-9,15,17-18H2,1-7H3,(H,31,35)(H,32,40)(H,33,38)(H,34,36)/b16-12+/t22-,26+/m1/s1 |
| InChIKey | QOXGSCITFDTNSJ-SEXIHWFSSA-N |
| XLogP | 2.69 |
| TPSA | 178.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|