C32H45N3O9 — CID 175449758
dicyclopentyl 2-[[2-[[2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]acetyl]amino]-3-methylbutanoyl]amino]pentanedioate (PubChem CID 175449758) has the molecular formula C32H45N3O9 and a molecular weight of 615.72 g/mol. Its IUPAC name is dicyclopentyl 2-[[2-[[2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]acetyl]amino]-3-methylbutanoyl]amino]pentanedioate.
| Compound Name | dicyclopentyl 2-[[2-[[2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]acetyl]amino]-3-methylbutanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 175449758 |
| Molecular Formula | C32H45N3O9 |
| Molecular Weight | 615.72 g/mol |
| Exact Mass | 615.32 |
| IUPAC Name | dicyclopentyl 2-[[2-[[2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]acetyl]amino]-3-methylbutanoyl]amino]pentanedioate |
| SMILES | COc1cc(/C=C/C(=O)NCC(=O)NC(C(=O)NC(CCC(=O)OC2CCCC2)C(=O)OC2CCCC2)C(C)C)ccc1O |
| InChI | InChI=1S/C32H45N3O9/c1-20(2)30(35-28(38)19-33-27(37)16-13-21-12-15-25(36)26(18-21)42-3)31(40)34-24(32(41)44-23-10-6-7-11-23)14-17-29(39)43-22-8-4-5-9-22/h12-13,15-16,18,20,22-24,30,36H,4-11,14,17,19H2,1-3H3,(H,33,37)(H,34,40)(H,35,38)/b16-13+ |
| InChIKey | VWOXYAUKDWVZSQ-DTQAZKPQSA-N |
| XLogP | 2.91 |
| TPSA | 169.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.72 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|