C19H17N3O4 — CID 162666133
(E)-N-[2-(4-cyanoanilino)-2-oxoethyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 162666133) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is (E)-N-[2-(4-cyanoanilino)-2-oxoethyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(4-cyanoanilino)-2-oxoethyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 162666133 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (E)-N-[2-(4-cyanoanilino)-2-oxoethyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCC(=O)Nc2ccc(C#N)cc2)ccc1O |
| InChI | InChI=1S/C19H17N3O4/c1-26-17-10-13(4-8-16(17)23)5-9-18(24)21-12-19(25)22-15-6-2-14(11-20)3-7-15/h2-10,23H,12H2,1H3,(H,21,24)(H,22,25)/b9-5+ |
| InChIKey | RZUFPBJWVPVXHS-WEVVVXLNSA-N |
| XLogP | 2.04 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|