C19H34N2O7 — CID 163263423
diethyl (2S)-2-[[(2S)-2-[deuterio-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-methylbutanoyl]amino]pentanedioate (PubChem CID 163263423) has the molecular formula C19H34N2O7 and a molecular weight of 403.49 g/mol. Its IUPAC name is diethyl (2S)-2-[[(2S)-2-[deuterio-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-methylbutanoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[(2S)-2-[deuterio-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-methylbutanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 163263423 |
| Molecular Formula | C19H34N2O7 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | diethyl (2S)-2-[[(2S)-2-[deuterio-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-methylbutanoyl]amino]pentanedioate |
| SMILES | [2H]N(C(=O)OC(C)(C)C)[C@H](C(=O)N[C@@H](CCC(=O)OCC)C(=O)OCC)C(C)C |
| InChI | InChI=1S/C19H34N2O7/c1-8-26-14(22)11-10-13(17(24)27-9-2)20-16(23)15(12(3)4)21-18(25)28-19(5,6)7/h12-13,15H,8-11H2,1-7H3,(H,20,23)(H,21,25)/t13-,15-/m0/s1/i/hD |
| InChIKey | XQUOXYWRTZLKBS-FPMSTDDNSA-N |
| XLogP | 1.93 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|