C16H23N3O2 — CID 66657873
(E)-N-[(2S)-2-[(2-aminoacetyl)amino]-3-methylbutyl]-3-phenylprop-2-enamide (PubChem CID 66657873) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (E)-N-[(2S)-2-[(2-aminoacetyl)amino]-3-methylbutyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(2S)-2-[(2-aminoacetyl)amino]-3-methylbutyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 66657873 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | (E)-N-[(2S)-2-[(2-aminoacetyl)amino]-3-methylbutyl]-3-phenylprop-2-enamide |
| SMILES | CC(C)[C@@H](CNC(=O)/C=C/c1ccccc1)NC(=O)CN |
| InChI | InChI=1S/C16H23N3O2/c1-12(2)14(19-16(21)10-17)11-18-15(20)9-8-13-6-4-3-5-7-13/h3-9,12,14H,10-11,17H2,1-2H3,(H,18,20)(H,19,21)/b9-8+/t14-/m1/s1 |
| InChIKey | ALJOSHUNZKTVAA-MYSGNRETSA-N |
| XLogP | 0.92 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|