C31H43N7O5 — CID 91400474
benzyl N-[(2S)-5-(diaminomethylideneamino)-1-[methyl-[2-[[(2S)-3-methyl-1-(3-phenylprop-2-enoylamino)butan-2-yl]amino]-2-oxoethyl]amino]-1-oxopentan-2-yl]carbamate (PubChem CID 91400474) has the molecular formula C31H43N7O5 and a molecular weight of 593.73 g/mol. Its IUPAC name is benzyl N-[(2S)-5-(diaminomethylideneamino)-1-[methyl-[2-[[(2S)-3-methyl-1-(3-phenylprop-2-enoylamino)butan-2-yl]amino]-2-oxoethyl]amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-5-(diaminomethylideneamino)-1-[methyl-[2-[[(2S)-3-methyl-1-(3-phenylprop-2-enoylamino)butan-2-yl]amino]-2-oxoethyl]amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 91400474 |
| Molecular Formula | C31H43N7O5 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.33 |
| IUPAC Name | benzyl N-[(2S)-5-(diaminomethylideneamino)-1-[methyl-[2-[[(2S)-3-methyl-1-(3-phenylprop-2-enoylamino)butan-2-yl]amino]-2-oxoethyl]amino]-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)[C@@H](CNC(=O)C=Cc1ccccc1)NC(=O)CN(C)C(=O)[C@H](CCCN=C(N)N)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H43N7O5/c1-22(2)26(19-35-27(39)17-16-23-11-6-4-7-12-23)36-28(40)20-38(3)29(41)25(15-10-18-34-30(32)33)37-31(42)43-21-24-13-8-5-9-14-24/h4-9,11-14,16-17,22,25-26H,10,15,18-21H2,1-3H3,(H,35,39)(H,36,40)(H,37,42)(H4,32,33,34)/t25-,26+/m0/s1 |
| InChIKey | FONSHZGXIQOJMG-IZZNHLLZSA-N |
| XLogP | 1.76 |
| TPSA | 181.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|