C35H53N7O5 — CID 24803983
benzyl N-[(2S)-1-[[(2S)-2-amino-4-methylpentanoyl]-[(2S)-3-methyl-1-(4-phenylbutanoylamino)butan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate (PubChem CID 24803983) has the molecular formula C35H53N7O5 and a molecular weight of 651.85 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2S)-2-amino-4-methylpentanoyl]-[(2S)-3-methyl-1-(4-phenylbutanoylamino)butan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(2S)-2-amino-4-methylpentanoyl]-[(2S)-3-methyl-1-(4-phenylbutanoylamino)butan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 24803983 |
| Molecular Formula | C35H53N7O5 |
| Molecular Weight | 651.85 g/mol |
| Exact Mass | 651.41 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S)-2-amino-4-methylpentanoyl]-[(2S)-3-methyl-1-(4-phenylbutanoylamino)butan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](N)C(=O)N(C(=O)[C@H](CCCN=C(N)N)NC(=O)OCc1ccccc1)[C@H](CNC(=O)CCCc1ccccc1)C(C)C |
| InChI | InChI=1S/C35H53N7O5/c1-24(2)21-28(36)32(44)42(30(25(3)4)22-40-31(43)19-11-17-26-13-7-5-8-14-26)33(45)29(18-12-20-39-34(37)38)41-35(46)47-23-27-15-9-6-10-16-27/h5-10,13-16,24-25,28-30H,11-12,17-23,36H2,1-4H3,(H,40,43)(H,41,46)(H4,37,38,39)/t28-,29-,30+/m0/s1 |
| InChIKey | KFXXGWOPUJGOQX-OIFRRMEBSA-N |
| XLogP | 3.23 |
| TPSA | 195.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.85 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|