C34H49N7O5 — CID 66657849
benzyl N-[(2R)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]-N-[(2S)-3-methyl-1-[[(E)-3-phenylprop-2-enoyl]amino]butan-2-yl]carbamate (PubChem CID 66657849) has the molecular formula C34H49N7O5 and a molecular weight of 635.81 g/mol. Its IUPAC name is benzyl N-[(2R)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]-N-[(2S)-3-methyl-1-[[(E)-3-phenylprop-2-enoyl]amino]butan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]-N-[(2S)-3-methyl-1-[[(E)-3-phenylprop-2-enoyl]amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 66657849 |
| Molecular Formula | C34H49N7O5 |
| Molecular Weight | 635.81 g/mol |
| Exact Mass | 635.38 |
| IUPAC Name | benzyl N-[(2R)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]-N-[(2S)-3-methyl-1-[[(E)-3-phenylprop-2-enoyl]amino]butan-2-yl]carbamate |
| SMILES | CC(C)C[C@@H](NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)N(C(=O)OCc1ccccc1)[C@H](CNC(=O)/C=C/c1ccccc1)C(C)C |
| InChI | InChI=1S/C34H49N7O5/c1-23(2)20-28(40-31(43)27(35)16-11-19-38-33(36)37)32(44)41(34(45)46-22-26-14-9-6-10-15-26)29(24(3)4)21-39-30(42)18-17-25-12-7-5-8-13-25/h5-10,12-15,17-18,23-24,27-29H,11,16,19-22,35H2,1-4H3,(H,39,42)(H,40,43)(H4,36,37,38)/b18-17+/t27-,28+,29+/m0/s1 |
| InChIKey | YSXAMJQGIDYZDX-SRZNSZEISA-N |
| XLogP | 2.92 |
| TPSA | 195.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.81 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|