C17H22N4O5 — CID 102301054
methyl 2-azido-6-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]hexanoate (PubChem CID 102301054) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is methyl 2-azido-6-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]hexanoate.
| Compound Name | methyl 2-azido-6-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]hexanoate |
|---|---|
| PubChem CID | 102301054 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | methyl 2-azido-6-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]hexanoate |
| SMILES | COC(=O)C(CCCCNC(=O)/C=C/c1ccc(O)c(OC)c1)N=[N+]=[N-] |
| InChI | InChI=1S/C17H22N4O5/c1-25-15-11-12(6-8-14(15)22)7-9-16(23)19-10-4-3-5-13(20-21-18)17(24)26-2/h6-9,11,13,22H,3-5,10H2,1-2H3,(H,19,23)/b9-7+ |
| InChIKey | HZYOICSBEFJWJP-VQHVLOKHSA-N |
| XLogP | 2.55 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|