C28H37N3O7 — CID 100917623
(E)-N-[4-[3-[[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]amino]propylamino]butyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 100917623) has the molecular formula C28H37N3O7 and a molecular weight of 527.62 g/mol. Its IUPAC name is (E)-N-[4-[3-[[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]amino]propylamino]butyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[3-[[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]amino]propylamino]butyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 100917623 |
| Molecular Formula | C28H37N3O7 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | (E)-N-[4-[3-[[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]amino]propylamino]butyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCCCCNCCCNC(=O)/C=C/c2cc(OC)c(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C28H37N3O7/c1-36-23-17-20(7-10-22(23)32)8-11-26(33)30-15-5-4-13-29-14-6-16-31-27(34)12-9-21-18-24(37-2)28(35)25(19-21)38-3/h7-12,17-19,29,32,35H,4-6,13-16H2,1-3H3,(H,30,33)(H,31,34)/b11-8+,12-9+ |
| InChIKey | PPJHMGDLWVTPRE-HZOWPXDZSA-N |
| XLogP | 2.84 |
| TPSA | 138.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|