C27H28O6 — CID 123678720
(1E,3E,8E,10E)-1-[3,4-bis(hydroxymethyl)phenyl]-11-(3,4-dimethoxyphenyl)undeca-1,3,8,10-tetraene-5,7-dione (PubChem CID 123678720) has the molecular formula C27H28O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is (1E,3E,8E,10E)-1-[3,4-bis(hydroxymethyl)phenyl]-11-(3,4-dimethoxyphenyl)undeca-1,3,8,10-tetraene-5,7-dione.
| Compound Name | (1E,3E,8E,10E)-1-[3,4-bis(hydroxymethyl)phenyl]-11-(3,4-dimethoxyphenyl)undeca-1,3,8,10-tetraene-5,7-dione |
|---|---|
| PubChem CID | 123678720 |
| Molecular Formula | C27H28O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | (1E,3E,8E,10E)-1-[3,4-bis(hydroxymethyl)phenyl]-11-(3,4-dimethoxyphenyl)undeca-1,3,8,10-tetraene-5,7-dione |
| SMILES | COc1ccc(/C=C/C=C/C(=O)CC(=O)/C=C/C=C/c2ccc(CO)c(CO)c2)cc1OC |
| InChI | InChI=1S/C27H28O6/c1-32-26-14-12-21(16-27(26)33-2)8-4-6-10-25(31)17-24(30)9-5-3-7-20-11-13-22(18-28)23(15-20)19-29/h3-16,28-29H,17-19H2,1-2H3/b7-3+,8-4+,9-5+,10-6+ |
| InChIKey | QIKUGNRWKKLZGG-JMFUVXGRSA-N |
| XLogP | 4.06 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|