C27H33NO5 — CID 123769357
1-[3,4-bis(hydroxymethyl)phenyl]-5-(diethylamino)-7-(3,4-dimethoxyphenyl)hepta-1,4,6-trien-3-one (PubChem CID 123769357) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is 1-[3,4-bis(hydroxymethyl)phenyl]-5-(diethylamino)-7-(3,4-dimethoxyphenyl)hepta-1,4,6-trien-3-one.
| Compound Name | 1-[3,4-bis(hydroxymethyl)phenyl]-5-(diethylamino)-7-(3,4-dimethoxyphenyl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 123769357 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 1-[3,4-bis(hydroxymethyl)phenyl]-5-(diethylamino)-7-(3,4-dimethoxyphenyl)hepta-1,4,6-trien-3-one |
| SMILES | CCN(CC)C(C=Cc1ccc(OC)c(OC)c1)=CC(=O)C=Cc1ccc(CO)c(CO)c1 |
| InChI | InChI=1S/C27H33NO5/c1-5-28(6-2)24(12-8-21-10-14-26(32-3)27(16-21)33-4)17-25(31)13-9-20-7-11-22(18-29)23(15-20)19-30/h7-17,29-30H,5-6,18-19H2,1-4H3 |
| InChIKey | DZODCJAWJOSJPN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|