C26H31NO5 — CID 25002668
(1E,4Z,6E)-1,7-bis(3,4-dimethoxyphenyl)-5-(propylamino)hepta-1,4,6-trien-3-one (PubChem CID 25002668) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is (1E,4Z,6E)-1,7-bis(3,4-dimethoxyphenyl)-5-(propylamino)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-1,7-bis(3,4-dimethoxyphenyl)-5-(propylamino)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 25002668 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | (1E,4Z,6E)-1,7-bis(3,4-dimethoxyphenyl)-5-(propylamino)hepta-1,4,6-trien-3-one |
| SMILES | CCCNC(=C\C(=O)/C=C/c1ccc(OC)c(OC)c1)/C=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H31NO5/c1-6-15-27-21(11-7-19-9-13-23(29-2)25(16-19)31-4)18-22(28)12-8-20-10-14-24(30-3)26(17-20)32-5/h7-14,16-18,27H,6,15H2,1-5H3/b11-7+,12-8+,21-18- |
| InChIKey | XPSDUTYETMHJGH-GLCQKXOASA-N |
| XLogP | 4.90 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|