C25H29NO6 — CID 134140782
(1E,4Z,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)-5-(3-methoxypropylamino)hepta-1,4,6-trien-3-one (PubChem CID 134140782) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is (1E,4Z,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)-5-(3-methoxypropylamino)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)-5-(3-methoxypropylamino)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 134140782 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | (1E,4Z,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)-5-(3-methoxypropylamino)hepta-1,4,6-trien-3-one |
| SMILES | COCCCNC(=C\C(=O)/C=C/c1ccc(O)c(OC)c1)/C=C/c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C25H29NO6/c1-30-14-4-13-26-20(9-5-18-7-11-22(28)24(15-18)31-2)17-21(27)10-6-19-8-12-23(29)25(16-19)32-3/h5-12,15-17,26,28-29H,4,13-14H2,1-3H3/b9-5+,10-6+,20-17- |
| InChIKey | CINBJTZMGYIBNQ-ORNAEUFTSA-N |
| XLogP | 3.92 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|