C44H50ClO14- — CID 159583877
1,5-bis(3,4-dimethoxyphenyl)penta-1,4-dien-3-one;4-[5-(3,4-dimethoxyphenyl)-3-ethoxypenta-1,4-dienyl]-1,2-dimethoxybenzene;perchlorate (PubChem CID 159583877) has the molecular formula C44H50ClO14- and a molecular weight of 838.32 g/mol. Its IUPAC name is 1,5-bis(3,4-dimethoxyphenyl)penta-1,4-dien-3-one;4-[5-(3,4-dimethoxyphenyl)-3-ethoxypenta-1,4-dienyl]-1,2-dimethoxybenzene;perchlorate.
| Compound Name | 1,5-bis(3,4-dimethoxyphenyl)penta-1,4-dien-3-one;4-[5-(3,4-dimethoxyphenyl)-3-ethoxypenta-1,4-dienyl]-1,2-dimethoxybenzene;perchlorate |
|---|---|
| PubChem CID | 159583877 |
| Molecular Formula | C44H50ClO14- |
| Molecular Weight | 838.32 g/mol |
| Exact Mass | 837.29 |
| IUPAC Name | 1,5-bis(3,4-dimethoxyphenyl)penta-1,4-dien-3-one;4-[5-(3,4-dimethoxyphenyl)-3-ethoxypenta-1,4-dienyl]-1,2-dimethoxybenzene;perchlorate |
| SMILES | CCOC(C=Cc1ccc(OC)c(OC)c1)C=Cc1ccc(OC)c(OC)c1.COc1ccc(C=CC(=O)C=Cc2ccc(OC)c(OC)c2)cc1OC.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H28O5.C21H22O5.ClHO4/c1-6-28-19(11-7-17-9-13-20(24-2)22(15-17)26-4)12-8-18-10-14-21(25-3)23(16-18)27-5;1-23-18-11-7-15(13-20(18)25-3)5-9-17(22)10-6-16-8-12-19(24-2)21(14-16)26-4;2-1(3,4)5/h7-16,19H,6H2,1-5H3;5-14H,1-4H3;(H,2,3,4,5)/p-1 |
| InChIKey | MJJCFIIBDCJHQT-UHFFFAOYSA-M |
| XLogP | 4.11 |
| TPSA | 192.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|