C31H33NO6 — CID 123605284
(1E,6E)-7-[3,4-bis(hydroxymethyl)phenyl]-1-(3,4-dimethoxyphenyl)-5-[(1S)-2-hydroxy-1-phenylethyl]iminohepta-1,6-dien-3-one (PubChem CID 123605284) has the molecular formula C31H33NO6 and a molecular weight of 515.61 g/mol. Its IUPAC name is (1E,6E)-7-[3,4-bis(hydroxymethyl)phenyl]-1-(3,4-dimethoxyphenyl)-5-[(1S)-2-hydroxy-1-phenylethyl]iminohepta-1,6-dien-3-one.
| Compound Name | (1E,6E)-7-[3,4-bis(hydroxymethyl)phenyl]-1-(3,4-dimethoxyphenyl)-5-[(1S)-2-hydroxy-1-phenylethyl]iminohepta-1,6-dien-3-one |
|---|---|
| PubChem CID | 123605284 |
| Molecular Formula | C31H33NO6 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | (1E,6E)-7-[3,4-bis(hydroxymethyl)phenyl]-1-(3,4-dimethoxyphenyl)-5-[(1S)-2-hydroxy-1-phenylethyl]iminohepta-1,6-dien-3-one |
| SMILES | COc1ccc(/C=C/C(=O)CC(/C=C/c2ccc(CO)c(CO)c2)=N/[C@H](CO)c2ccccc2)cc1OC |
| InChI | InChI=1S/C31H33NO6/c1-37-30-15-11-23(17-31(30)38-2)10-14-28(36)18-27(32-29(21-35)24-6-4-3-5-7-24)13-9-22-8-12-25(19-33)26(16-22)20-34/h3-17,29,33-35H,18-21H2,1-2H3/b13-9+,14-10+,32-27+/t29-/m1/s1 |
| InChIKey | WSRJWBBBGDFXID-ZIZLGQNASA-N |
| XLogP | 4.55 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|