C18H27N3O4 — CID 94811357
2-[[2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]amino]-4,5-dimethoxybenzamide (PubChem CID 94811357) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-[[2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]amino]-4,5-dimethoxybenzamide.
| Compound Name | 2-[[2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]amino]-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 94811357 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 2-[[2-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]amino]-4,5-dimethoxybenzamide |
| SMILES | COc1cc(NCC(=O)N2[C@H](C)CCC[C@@H]2C)c(C(N)=O)cc1OC |
| InChI | InChI=1S/C18H27N3O4/c1-11-6-5-7-12(2)21(11)17(22)10-20-14-9-16(25-4)15(24-3)8-13(14)18(19)23/h8-9,11-12,20H,5-7,10H2,1-4H3,(H2,19,23)/t11-,12+ |
| InChIKey | TUIYFALPFNJVTP-TXEJJXNPSA-N |
| XLogP | 2.00 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|