C16H24N2O5 — CID 51098543
4,5-dimethoxy-2-[3-(2-methylpropoxy)propanoylamino]benzamide (PubChem CID 51098543) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4,5-dimethoxy-2-[3-(2-methylpropoxy)propanoylamino]benzamide.
| Compound Name | 4,5-dimethoxy-2-[3-(2-methylpropoxy)propanoylamino]benzamide |
|---|---|
| PubChem CID | 51098543 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 4,5-dimethoxy-2-[3-(2-methylpropoxy)propanoylamino]benzamide |
| SMILES | COc1cc(NC(=O)CCOCC(C)C)c(C(N)=O)cc1OC |
| InChI | InChI=1S/C16H24N2O5/c1-10(2)9-23-6-5-15(19)18-12-8-14(22-4)13(21-3)7-11(12)16(17)20/h7-8,10H,5-6,9H2,1-4H3,(H2,17,20)(H,18,19) |
| InChIKey | FLOIPWVJNDXATH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|