C10H17Cl2N3O2 — CID 119868833
(2S)-2-amino-N-(4-methoxy-3-pyridinyl)butanamide;dihydrochloride (PubChem CID 119868833) has the molecular formula C10H17Cl2N3O2 and a molecular weight of 282.17 g/mol. Its IUPAC name is (2S)-2-amino-N-(4-methoxy-3-pyridinyl)butanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-N-(4-methoxy-3-pyridinyl)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119868833 |
| Molecular Formula | C10H17Cl2N3O2 |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (2S)-2-amino-N-(4-methoxy-3-pyridinyl)butanamide;dihydrochloride |
| SMILES | CC[C@H](N)C(=O)Nc1cnccc1OC.Cl.Cl |
| InChI | InChI=1S/C10H15N3O2.2ClH/c1-3-7(11)10(14)13-8-6-12-5-4-9(8)15-2;;/h4-7H,3,11H2,1-2H3,(H,13,14);2*1H/t7-;;/m0../s1 |
| InChIKey | UZPCTYPNPZHLCM-KLXURFKVSA-N |
| XLogP | 1.61 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |