C11H16N2O2 — CID 176872995
N-(4-methoxy-3-pyridinyl)-3-methylbutanamide (PubChem CID 176872995) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is N-(4-methoxy-3-pyridinyl)-3-methylbutanamide.
| Compound Name | N-(4-methoxy-3-pyridinyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 176872995 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N-(4-methoxy-3-pyridinyl)-3-methylbutanamide |
| SMILES | COc1ccncc1NC(=O)CC(C)C |
| InChI | InChI=1S/C11H16N2O2/c1-8(2)6-11(14)13-9-7-12-5-4-10(9)15-3/h4-5,7-8H,6H2,1-3H3,(H,13,14) |
| InChIKey | YCAKQONOYUCDAR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |