C14H22N2O2 — CID 68857725
(3S,5R)-3-amino-7-anilino-5-methylheptanoic acid (PubChem CID 68857725) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is (3S,5R)-3-amino-7-anilino-5-methylheptanoic acid.
| Compound Name | (3S,5R)-3-amino-7-anilino-5-methylheptanoic acid |
|---|---|
| PubChem CID | 68857725 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (3S,5R)-3-amino-7-anilino-5-methylheptanoic acid |
| SMILES | C[C@H](CCNc1ccccc1)C[C@H](N)CC(=O)O |
| InChI | InChI=1S/C14H22N2O2/c1-11(9-12(15)10-14(17)18)7-8-16-13-5-3-2-4-6-13/h2-6,11-12,16H,7-10,15H2,1H3,(H,17,18)/t11-,12+/m1/s1 |
| InChIKey | XWNWLFBIMCWZGL-NEPJUHHUSA-N |
| XLogP | 2.32 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |