C14H24N2O2 — CID 67669423
(2S)-2-amino-3-methylbutanoic acid;N-propylaniline (PubChem CID 67669423) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoic acid;N-propylaniline.
| Compound Name | (2S)-2-amino-3-methylbutanoic acid;N-propylaniline |
|---|---|
| PubChem CID | 67669423 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoic acid;N-propylaniline |
| SMILES | CC(C)[C@H](N)C(=O)O.CCCNc1ccccc1 |
| InChI | InChI=1S/C9H13N.C5H11NO2/c1-2-8-10-9-6-4-3-5-7-9;1-3(2)4(6)5(7)8/h3-7,10H,2,8H2,1H3;3-4H,6H2,1-2H3,(H,7,8)/t;4-/m.0/s1 |
| InChIKey | YZLBIVACEYCLAW-VWMHFEHESA-N |
| XLogP | 2.56 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |