C13H21N — CID 89346874
N-(3,4-dimethylpentyl)aniline (PubChem CID 89346874) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is N-(3,4-dimethylpentyl)aniline.
| Compound Name | N-(3,4-dimethylpentyl)aniline |
|---|---|
| PubChem CID | 89346874 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | N-(3,4-dimethylpentyl)aniline |
| SMILES | CC(C)C(C)CCNc1ccccc1 |
| InChI | InChI=1S/C13H21N/c1-11(2)12(3)9-10-14-13-7-5-4-6-8-13/h4-8,11-12,14H,9-10H2,1-3H3 |
| InChIKey | FQSGGUHGAGCIGG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |