C15H17FN2O2 — CID 18371387
3-[4-amino-2-(3-fluorophenyl)anilino]propane-1,2-diol (PubChem CID 18371387) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is 3-[4-amino-2-(3-fluorophenyl)anilino]propane-1,2-diol.
| Compound Name | 3-[4-amino-2-(3-fluorophenyl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 18371387 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 3-[4-amino-2-(3-fluorophenyl)anilino]propane-1,2-diol |
| SMILES | Nc1ccc(NCC(O)CO)c(-c2cccc(F)c2)c1 |
| InChI | InChI=1S/C15H17FN2O2/c16-11-3-1-2-10(6-11)14-7-12(17)4-5-15(14)18-8-13(20)9-19/h1-7,13,18-20H,8-9,17H2 |
| InChIKey | NAIUCWOWJJFXBQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|