C15H19N3O2 — CID 154240692
3-[2,4-diamino-6-(3-aminophenyl)phenyl]propane-1,2-diol (PubChem CID 154240692) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-[2,4-diamino-6-(3-aminophenyl)phenyl]propane-1,2-diol.
| Compound Name | 3-[2,4-diamino-6-(3-aminophenyl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 154240692 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-[2,4-diamino-6-(3-aminophenyl)phenyl]propane-1,2-diol |
| SMILES | Nc1cccc(-c2cc(N)cc(N)c2CC(O)CO)c1 |
| InChI | InChI=1S/C15H19N3O2/c16-10-3-1-2-9(4-10)13-5-11(17)6-15(18)14(13)7-12(20)8-19/h1-6,12,19-20H,7-8,16-18H2 |
| InChIKey | HOONOCQELZDNLD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|