C13H16N2O2S — CID 154493893
3-(2,4-diamino-6-thiophen-3-ylphenyl)propane-1,2-diol (PubChem CID 154493893) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-(2,4-diamino-6-thiophen-3-ylphenyl)propane-1,2-diol.
| Compound Name | 3-(2,4-diamino-6-thiophen-3-ylphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 154493893 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 3-(2,4-diamino-6-thiophen-3-ylphenyl)propane-1,2-diol |
| SMILES | Nc1cc(N)c(CC(O)CO)c(-c2ccsc2)c1 |
| InChI | InChI=1S/C13H16N2O2S/c14-9-3-11(8-1-2-18-7-8)12(13(15)4-9)5-10(17)6-16/h1-4,7,10,16-17H,5-6,14-15H2 |
| InChIKey | PVOYLSLVLRHVHK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|