C15H20N4O2 — CID 154276954
3-[2,4-diamino-6-(3,5-diaminophenyl)phenyl]propane-1,2-diol (PubChem CID 154276954) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-[2,4-diamino-6-(3,5-diaminophenyl)phenyl]propane-1,2-diol.
| Compound Name | 3-[2,4-diamino-6-(3,5-diaminophenyl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 154276954 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 3-[2,4-diamino-6-(3,5-diaminophenyl)phenyl]propane-1,2-diol |
| SMILES | Nc1cc(N)cc(-c2cc(N)cc(N)c2CC(O)CO)c1 |
| InChI | InChI=1S/C15H20N4O2/c16-9-1-8(2-10(17)3-9)13-4-11(18)5-15(19)14(13)6-12(21)7-20/h1-5,12,20-21H,6-7,16-19H2 |
| InChIKey | UKNMNPDLCAUAGH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 144.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|