C14H24N2O4 — CID 141033218
4-[3,6-diamino-2-(3,4-dihydroxybutyl)phenyl]butane-1,2-diol (PubChem CID 141033218) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-[3,6-diamino-2-(3,4-dihydroxybutyl)phenyl]butane-1,2-diol.
| Compound Name | 4-[3,6-diamino-2-(3,4-dihydroxybutyl)phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 141033218 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 4-[3,6-diamino-2-(3,4-dihydroxybutyl)phenyl]butane-1,2-diol |
| SMILES | Nc1ccc(N)c(CCC(O)CO)c1CCC(O)CO |
| InChI | InChI=1S/C14H24N2O4/c15-13-5-6-14(16)12(4-2-10(20)8-18)11(13)3-1-9(19)7-17/h5-6,9-10,17-20H,1-4,7-8,15-16H2 |
| InChIKey | HFQFHYPLYWUFAE-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|