C15H26N2O4S — CID 59090215
4-[4-amino-N-(3,4-dihydroxybutyl)-3-methylsulfanylanilino]butane-1,2-diol (PubChem CID 59090215) has the molecular formula C15H26N2O4S and a molecular weight of 330.45 g/mol. Its IUPAC name is 4-[4-amino-N-(3,4-dihydroxybutyl)-3-methylsulfanylanilino]butane-1,2-diol.
| Compound Name | 4-[4-amino-N-(3,4-dihydroxybutyl)-3-methylsulfanylanilino]butane-1,2-diol |
|---|---|
| PubChem CID | 59090215 |
| Molecular Formula | C15H26N2O4S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-[4-amino-N-(3,4-dihydroxybutyl)-3-methylsulfanylanilino]butane-1,2-diol |
| SMILES | CSc1cc(N(CCC(O)CO)CCC(O)CO)ccc1N |
| InChI | InChI=1S/C15H26N2O4S/c1-22-15-8-11(2-3-14(15)16)17(6-4-12(20)9-18)7-5-13(21)10-19/h2-3,8,12-13,18-21H,4-7,9-10,16H2,1H3 |
| InChIKey | UDTUHSCAOPBEBG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|