C19H34N2 — CID 160824799
4-N,4-N-dibutyl-2-(3-methylbutyl)benzene-1,4-diamine (PubChem CID 160824799) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is 4-N,4-N-dibutyl-2-(3-methylbutyl)benzene-1,4-diamine.
| Compound Name | 4-N,4-N-dibutyl-2-(3-methylbutyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 160824799 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | 4-N,4-N-dibutyl-2-(3-methylbutyl)benzene-1,4-diamine |
| SMILES | CCCCN(CCCC)c1ccc(N)c(CCC(C)C)c1 |
| InChI | InChI=1S/C19H34N2/c1-5-7-13-21(14-8-6-2)18-11-12-19(20)17(15-18)10-9-16(3)4/h11-12,15-16H,5-10,13-14,20H2,1-4H3 |
| InChIKey | RPGJHRBTTQIBFK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|