C16H28N2O5 — CID 59090244
4-[4-amino-N-(3,4-dihydroxybutyl)-3-ethoxyanilino]butane-1,2-diol (PubChem CID 59090244) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is 4-[4-amino-N-(3,4-dihydroxybutyl)-3-ethoxyanilino]butane-1,2-diol.
| Compound Name | 4-[4-amino-N-(3,4-dihydroxybutyl)-3-ethoxyanilino]butane-1,2-diol |
|---|---|
| PubChem CID | 59090244 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 4-[4-amino-N-(3,4-dihydroxybutyl)-3-ethoxyanilino]butane-1,2-diol |
| SMILES | CCOc1cc(N(CCC(O)CO)CCC(O)CO)ccc1N |
| InChI | InChI=1S/C16H28N2O5/c1-2-23-16-9-12(3-4-15(16)17)18(7-5-13(21)10-19)8-6-14(22)11-20/h3-4,9,13-14,19-22H,2,5-8,10-11,17H2,1H3 |
| InChIKey | USHAUNCKXJTIRM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|