C12H19NO6 — CID 70408589
3-[3-amino-5-(2,3-dihydroxypropoxy)phenoxy]propane-1,2-diol (PubChem CID 70408589) has the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. Its IUPAC name is 3-[3-amino-5-(2,3-dihydroxypropoxy)phenoxy]propane-1,2-diol.
| Compound Name | 3-[3-amino-5-(2,3-dihydroxypropoxy)phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 70408589 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 3-[3-amino-5-(2,3-dihydroxypropoxy)phenoxy]propane-1,2-diol |
| SMILES | Nc1cc(OCC(O)CO)cc(OCC(O)CO)c1 |
| InChI | InChI=1S/C12H19NO6/c13-8-1-11(18-6-9(16)4-14)3-12(2-8)19-7-10(17)5-15/h1-3,9-10,14-17H,4-7,13H2 |
| InChIKey | LZCILRGBQVCCKS-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|