C15H20N4O2 — CID 18371380
3-[4-amino-2-(2,4-diaminophenyl)anilino]propane-1,2-diol (PubChem CID 18371380) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-[4-amino-2-(2,4-diaminophenyl)anilino]propane-1,2-diol.
| Compound Name | 3-[4-amino-2-(2,4-diaminophenyl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 18371380 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 3-[4-amino-2-(2,4-diaminophenyl)anilino]propane-1,2-diol |
| SMILES | Nc1ccc(-c2cc(N)ccc2NCC(O)CO)c(N)c1 |
| InChI | InChI=1S/C15H20N4O2/c16-9-2-4-15(19-7-11(21)8-20)13(5-9)12-3-1-10(17)6-14(12)18/h1-6,11,19-21H,7-8,16-18H2 |
| InChIKey | PMXJKQSDLNTQNS-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|