C15H19N3O3 — CID 18371761
3-[4-amino-3-(5-amino-2-hydroxyphenyl)anilino]propane-1,2-diol (PubChem CID 18371761) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 3-[4-amino-3-(5-amino-2-hydroxyphenyl)anilino]propane-1,2-diol.
| Compound Name | 3-[4-amino-3-(5-amino-2-hydroxyphenyl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 18371761 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 3-[4-amino-3-(5-amino-2-hydroxyphenyl)anilino]propane-1,2-diol |
| SMILES | Nc1ccc(O)c(-c2cc(NCC(O)CO)ccc2N)c1 |
| InChI | InChI=1S/C15H19N3O3/c16-9-1-4-15(21)13(5-9)12-6-10(2-3-14(12)17)18-7-11(20)8-19/h1-6,11,18-21H,7-8,16-17H2 |
| InChIKey | GAFSHUNDZJARHH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|