C13H19Br2NO3 — CID 61467302
1-(2,5-dibromoanilino)-3-(2-ethoxyethoxy)propan-2-ol (PubChem CID 61467302) has the molecular formula C13H19Br2NO3 and a molecular weight of 397.11 g/mol. Its IUPAC name is 1-(2,5-dibromoanilino)-3-(2-ethoxyethoxy)propan-2-ol.
| Compound Name | 1-(2,5-dibromoanilino)-3-(2-ethoxyethoxy)propan-2-ol |
|---|---|
| PubChem CID | 61467302 |
| Molecular Formula | C13H19Br2NO3 |
| Molecular Weight | 397.11 g/mol |
| Exact Mass | 394.97 |
| IUPAC Name | 1-(2,5-dibromoanilino)-3-(2-ethoxyethoxy)propan-2-ol |
| SMILES | CCOCCOCC(O)CNc1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H19Br2NO3/c1-2-18-5-6-19-9-11(17)8-16-13-7-10(14)3-4-12(13)15/h3-4,7,11,16-17H,2,5-6,8-9H2,1H3 |
| InChIKey | SPPNVCKHAKLTSU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.11 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|