C15H23BrFNO2 — CID 60897310
1-(4-bromo-2-fluoroanilino)-3-(4-methylpentan-2-yloxy)propan-2-ol (PubChem CID 60897310) has the molecular formula C15H23BrFNO2 and a molecular weight of 348.26 g/mol. Its IUPAC name is 1-(4-bromo-2-fluoroanilino)-3-(4-methylpentan-2-yloxy)propan-2-ol.
| Compound Name | 1-(4-bromo-2-fluoroanilino)-3-(4-methylpentan-2-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 60897310 |
| Molecular Formula | C15H23BrFNO2 |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-(4-bromo-2-fluoroanilino)-3-(4-methylpentan-2-yloxy)propan-2-ol |
| SMILES | CC(C)CC(C)OCC(O)CNc1ccc(Br)cc1F |
| InChI | InChI=1S/C15H23BrFNO2/c1-10(2)6-11(3)20-9-13(19)8-18-15-5-4-12(16)7-14(15)17/h4-5,7,10-11,13,18-19H,6,8-9H2,1-3H3 |
| InChIKey | UNJHWURQTZXWGD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |