C22H33N3O6 — CID 14210786
[1-[3-[[2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]amino]-3-methylbutanoyl]piperidin-4-yl] nitrate (PubChem CID 14210786) has the molecular formula C22H33N3O6 and a molecular weight of 435.52 g/mol. Its IUPAC name is [1-[3-[[2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]amino]-3-methylbutanoyl]piperidin-4-yl] nitrate.
| Compound Name | [1-[3-[[2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]amino]-3-methylbutanoyl]piperidin-4-yl] nitrate |
|---|---|
| PubChem CID | 14210786 |
| Molecular Formula | C22H33N3O6 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | [1-[3-[[2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]amino]-3-methylbutanoyl]piperidin-4-yl] nitrate |
| SMILES | C=CCc1ccccc1OCC(O)CNC(C)(C)CC(=O)N1CCC(O[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H33N3O6/c1-4-7-17-8-5-6-9-20(17)30-16-18(26)15-23-22(2,3)14-21(27)24-12-10-19(11-13-24)31-25(28)29/h4-6,8-9,18-19,23,26H,1,7,10-16H2,2-3H3 |
| InChIKey | NGJPREUZBKMKFD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|