C23H35N3O8 — CID 70411860
ethyl 2-[[4-[[2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]amino]-4-methylpentanoyl]amino]-3-nitrooxypropanoate (PubChem CID 70411860) has the molecular formula C23H35N3O8 and a molecular weight of 481.55 g/mol. Its IUPAC name is ethyl 2-[[4-[[2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]amino]-4-methylpentanoyl]amino]-3-nitrooxypropanoate.
| Compound Name | ethyl 2-[[4-[[2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]amino]-4-methylpentanoyl]amino]-3-nitrooxypropanoate |
|---|---|
| PubChem CID | 70411860 |
| Molecular Formula | C23H35N3O8 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | ethyl 2-[[4-[[2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]amino]-4-methylpentanoyl]amino]-3-nitrooxypropanoate |
| SMILES | C=CCc1ccccc1OCC(O)CNC(C)(C)CCC(=O)NC(CO[N+](=O)[O-])C(=O)OCC |
| InChI | InChI=1S/C23H35N3O8/c1-5-9-17-10-7-8-11-20(17)33-15-18(27)14-24-23(3,4)13-12-21(28)25-19(16-34-26(30)31)22(29)32-6-2/h5,7-8,10-11,18-19,24,27H,1,6,9,12-16H2,2-4H3,(H,25,28) |
| InChIKey | CDQUYZZKJZIXCX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|