C17H28N2O5 — CID 91518700
3-[[2-hydroxy-3-(2-methoxyphenoxy)propyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanamide (PubChem CID 91518700) has the molecular formula C17H28N2O5 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-[[2-hydroxy-3-(2-methoxyphenoxy)propyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanamide.
| Compound Name | 3-[[2-hydroxy-3-(2-methoxyphenoxy)propyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanamide |
|---|---|
| PubChem CID | 91518700 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 3-[[2-hydroxy-3-(2-methoxyphenoxy)propyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanamide |
| SMILES | COc1ccccc1OCC(O)CNC(CC(N)=O)OC(C)(C)C |
| InChI | InChI=1S/C17H28N2O5/c1-17(2,3)24-16(9-15(18)21)19-10-12(20)11-23-14-8-6-5-7-13(14)22-4/h5-8,12,16,19-20H,9-11H2,1-4H3,(H2,18,21) |
| InChIKey | KIGAMYXJAGDQKG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|