C11H15F2NO2 — CID 63038505
1-(2,3-difluorophenoxy)-3-(ethylamino)propan-2-ol (PubChem CID 63038505) has the molecular formula C11H15F2NO2 and a molecular weight of 231.24 g/mol. Its IUPAC name is 1-(2,3-difluorophenoxy)-3-(ethylamino)propan-2-ol.
| Compound Name | 1-(2,3-difluorophenoxy)-3-(ethylamino)propan-2-ol |
|---|---|
| PubChem CID | 63038505 |
| Molecular Formula | C11H15F2NO2 |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 1-(2,3-difluorophenoxy)-3-(ethylamino)propan-2-ol |
| SMILES | CCNCC(O)COc1cccc(F)c1F |
| InChI | InChI=1S/C11H15F2NO2/c1-2-14-6-8(15)7-16-10-5-3-4-9(12)11(10)13/h3-5,8,14-15H,2,6-7H2,1H3 |
| InChIKey | DWUDFCBLICDZTO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |