C17H28ClNO2 — CID 81370810
1-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-3-(4-methylpentan-2-yloxy)propan-2-ol (PubChem CID 81370810) has the molecular formula C17H28ClNO2 and a molecular weight of 313.87 g/mol. Its IUPAC name is 1-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-3-(4-methylpentan-2-yloxy)propan-2-ol.
| Compound Name | 1-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-3-(4-methylpentan-2-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 81370810 |
| Molecular Formula | C17H28ClNO2 |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-3-(4-methylpentan-2-yloxy)propan-2-ol |
| SMILES | CC(C)CC(C)OCC(O)CN[C@@H](C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H28ClNO2/c1-12(2)8-13(3)21-11-17(20)10-19-14(4)15-6-5-7-16(18)9-15/h5-7,9,12-14,17,19-20H,8,10-11H2,1-4H3/t13?,14-,17?/m0/s1 |
| InChIKey | CHWXIZIUAJMOSL-UUCFBXCCSA-N |
| XLogP | 3.80 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |