C19H32NO+ — CID 22415986
1-benzyl-1-(2-butoxypropyl)piperidin-1-ium (PubChem CID 22415986) has the molecular formula C19H32NO+ and a molecular weight of 290.47 g/mol. Its IUPAC name is 1-benzyl-1-(2-butoxypropyl)piperidin-1-ium.
| Compound Name | 1-benzyl-1-(2-butoxypropyl)piperidin-1-ium |
|---|---|
| PubChem CID | 22415986 |
| Molecular Formula | C19H32NO+ |
| Molecular Weight | 290.47 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 1-benzyl-1-(2-butoxypropyl)piperidin-1-ium |
| SMILES | CCCCOC(C)C[N+]1(Cc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C19H32NO/c1-3-4-15-21-18(2)16-20(13-9-6-10-14-20)17-19-11-7-5-8-12-19/h5,7-8,11-12,18H,3-4,6,9-10,13-17H2,1-2H3/q+1 |
| InChIKey | VYRGQTHIYFUGBM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|