C15H24O2 — CID 57055398
[(2R,3S)-3-butoxybutan-2-yl]oxymethylbenzene (PubChem CID 57055398) has the molecular formula C15H24O2 and a molecular weight of 236.36 g/mol. Its IUPAC name is [(2R,3S)-3-butoxybutan-2-yl]oxymethylbenzene.
| Compound Name | [(2R,3S)-3-butoxybutan-2-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 57055398 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | [(2R,3S)-3-butoxybutan-2-yl]oxymethylbenzene |
| SMILES | CCCCO[C@@H](C)[C@@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C15H24O2/c1-4-5-11-16-13(2)14(3)17-12-15-9-7-6-8-10-15/h6-10,13-14H,4-5,11-12H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | WZEOXAVMJCDWOS-UONOGXRCSA-N |
| XLogP | 3.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|